C10H9BrF2O3 — CID 131748200
methyl (2R)-2-(4-bromo-2,6-difluorophenoxy)propanoate (PubChem CID 131748200) has the molecular formula C10H9BrF2O3 and a molecular weight of 295.08 g/mol. Its IUPAC name is methyl (2R)-2-(4-bromo-2,6-difluorophenoxy)propanoate.
| Compound Name | methyl (2R)-2-(4-bromo-2,6-difluorophenoxy)propanoate |
|---|---|
| PubChem CID | 131748200 |
| Molecular Formula | C10H9BrF2O3 |
| Molecular Weight | 295.08 g/mol |
| Exact Mass | 293.97 |
| IUPAC Name | methyl (2R)-2-(4-bromo-2,6-difluorophenoxy)propanoate |
| SMILES | COC(=O)[C@@H](C)Oc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C10H9BrF2O3/c1-5(10(14)15-2)16-9-7(12)3-6(11)4-8(9)13/h3-5H,1-2H3/t5-/m1/s1 |
| InChIKey | ZWTRVNAGPBMQAC-RXMQYKEDSA-N |
| XLogP | 2.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.08 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |