C11H13ClF3N3O2 — CID 70009064
guanidine;2-methyl-3-(2,3,6-trifluorophenyl)prop-2-enoic acid;hydrochloride (PubChem CID 70009064) has the molecular formula C11H13ClF3N3O2 and a molecular weight of 311.69 g/mol. Its IUPAC name is guanidine;2-methyl-3-(2,3,6-trifluorophenyl)prop-2-enoic acid;hydrochloride.
| Compound Name | guanidine;2-methyl-3-(2,3,6-trifluorophenyl)prop-2-enoic acid;hydrochloride |
|---|---|
| PubChem CID | 70009064 |
| Molecular Formula | C11H13ClF3N3O2 |
| Molecular Weight | 311.69 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | guanidine;2-methyl-3-(2,3,6-trifluorophenyl)prop-2-enoic acid;hydrochloride |
| SMILES | CC(=Cc1c(F)ccc(F)c1F)C(=O)O.Cl.[H]N=C(N)N |
| InChI | InChI=1S/C10H7F3O2.CH5N3.ClH/c1-5(10(14)15)4-6-7(11)2-3-8(12)9(6)13;2-1(3)4;/h2-4H,1H3,(H,14,15);(H5,2,3,4);1H |
| InChIKey | RZXWYOLOAJYYQG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 113.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.69 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|