About (2Z)-3-oxo-2-[(2,3,4-trifluorophenyl)methylidene]butanoic acid
(2Z)-3-oxo-2-[(2,3,4-trifluorophenyl)methylidene]butanoic acid (PubChem CID 70486561) has the molecular formula C11H7F3O3
and a molecular weight of 244.17 g/mol. Its IUPAC name is (2Z)-3-oxo-2-[(2,3,4-trifluorophenyl)methylidene]butanoic acid.
Molecular Properties
| Compound Name | (2Z)-3-oxo-2-[(2,3,4-trifluorophenyl)methylidene]butanoic acid |
| PubChem CID | 70486561 |
| Molecular Formula | C11H7F3O3 |
| Molecular Weight | 244.17 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | (2Z)-3-oxo-2-[(2,3,4-trifluorophenyl)methylidene]butanoic acid |
| SMILES | CC(=O)/C(=C/c1ccc(F)c(F)c1F)C(=O)O |
| InChI | InChI=1S/C11H7F3O3/c1-5(15)7(11(16)17)4-6-2-3-8(12)10(14)9(6)13/h2-4H,1H3,(H,16,17)/b7-4- |
| InChIKey | ZDLVGSPMDBMWRT-DAXSKMNVSA-N |
| XLogP | 2.16 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.17 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-3-oxo-2-[(2,3,4-trifluorophenyl)methylidene]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-3-oxo-2-[(2,3,4-trifluorophenyl)methylidene]butanoic acid?
The IUPAC name of (2Z)-3-oxo-2-[(2,3,4-trifluorophenyl)methylidene]butanoic acid (CID 70486561) is (2Z)-3-oxo-2-[(2,3,4-trifluorophenyl)methylidene]butanoic acid.
What is the SMILES notation for (2Z)-3-oxo-2-[(2,3,4-trifluorophenyl)methylidene]butanoic acid?
The canonical SMILES for (2Z)-3-oxo-2-[(2,3,4-trifluorophenyl)methylidene]butanoic acid is CC(=O)/C(=C/c1ccc(F)c(F)c1F)C(=O)O.
What is the InChIKey of (2Z)-3-oxo-2-[(2,3,4-trifluorophenyl)methylidene]butanoic acid?
The InChIKey is ZDLVGSPMDBMWRT-DAXSKMNVSA-N. The full InChI is InChI=1S/C11H7F3O3/c1-5(15)7(11(16)17)4-6-2-3-8(12)10(14)9(6)13/h2-4H,1H3,(H,16,17)/b7-4-.
What are the key properties of (2Z)-3-oxo-2-[(2,3,4-trifluorophenyl)methylidene]butanoic acid?
(2Z)-3-oxo-2-[(2,3,4-trifluorophenyl)methylidene]butanoic acid has a molecular weight of 244.17 g/mol, XLogP of 2.16, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-3-oxo-2-[(2,3,4-trifluorophenyl)methylidene]butanoic acid is sourced from PubChem (CID 70486561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).