C12H9F3O3 — CID 70043020
(2Z)-3-oxo-2-[[2-(trifluoromethyl)phenyl]methylidene]butanoic acid (PubChem CID 70043020) has the molecular formula C12H9F3O3 and a molecular weight of 258.19 g/mol. Its IUPAC name is (2Z)-3-oxo-2-[[2-(trifluoromethyl)phenyl]methylidene]butanoic acid.
| Compound Name | (2Z)-3-oxo-2-[[2-(trifluoromethyl)phenyl]methylidene]butanoic acid |
|---|---|
| PubChem CID | 70043020 |
| Molecular Formula | C12H9F3O3 |
| Molecular Weight | 258.19 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | (2Z)-3-oxo-2-[[2-(trifluoromethyl)phenyl]methylidene]butanoic acid |
| SMILES | CC(=O)/C(=C/c1ccccc1C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C12H9F3O3/c1-7(16)9(11(17)18)6-8-4-2-3-5-10(8)12(13,14)15/h2-6H,1H3,(H,17,18)/b9-6- |
| InChIKey | ZPIBNRBMPJVTSK-TWGQIWQCSA-N |
| XLogP | 2.76 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.19 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|