C12H8ClF3O3 — CID 67745251
(2E)-2-[[4-chloro-3-(trifluoromethyl)phenyl]methylidene]-3-oxobutanoic acid (PubChem CID 67745251) has the molecular formula C12H8ClF3O3 and a molecular weight of 292.64 g/mol. Its IUPAC name is (2E)-2-[[4-chloro-3-(trifluoromethyl)phenyl]methylidene]-3-oxobutanoic acid.
| Compound Name | (2E)-2-[[4-chloro-3-(trifluoromethyl)phenyl]methylidene]-3-oxobutanoic acid |
|---|---|
| PubChem CID | 67745251 |
| Molecular Formula | C12H8ClF3O3 |
| Molecular Weight | 292.64 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | (2E)-2-[[4-chloro-3-(trifluoromethyl)phenyl]methylidene]-3-oxobutanoic acid |
| SMILES | CC(=O)/C(=C\c1ccc(Cl)c(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C12H8ClF3O3/c1-6(17)8(11(18)19)4-7-2-3-10(13)9(5-7)12(14,15)16/h2-5H,1H3,(H,18,19)/b8-4+ |
| InChIKey | CHYUIGPGMJPVFW-XBXARRHUSA-N |
| XLogP | 3.42 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.64 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|