C12H9ClF3NO3 — CID 69197152
2-acetamido-3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enoic acid (PubChem CID 69197152) has the molecular formula C12H9ClF3NO3 and a molecular weight of 307.66 g/mol. Its IUPAC name is 2-acetamido-3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enoic acid.
| Compound Name | 2-acetamido-3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 69197152 |
| Molecular Formula | C12H9ClF3NO3 |
| Molecular Weight | 307.66 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 2-acetamido-3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enoic acid |
| SMILES | CC(=O)NC(=Cc1ccc(Cl)c(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C12H9ClF3NO3/c1-6(18)17-10(11(19)20)5-7-2-3-9(13)8(4-7)12(14,15)16/h2-5H,1H3,(H,17,18)(H,19,20) |
| InChIKey | PFIQABDHKLIJKO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.66 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|