C13H12F3NO3 — CID 102755666
(E)-2-acetamido-3-[2-methyl-4-(trifluoromethyl)phenyl]prop-2-enoic acid (PubChem CID 102755666) has the molecular formula C13H12F3NO3 and a molecular weight of 287.24 g/mol. Its IUPAC name is (E)-2-acetamido-3-[2-methyl-4-(trifluoromethyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-2-acetamido-3-[2-methyl-4-(trifluoromethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 102755666 |
| Molecular Formula | C13H12F3NO3 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | (E)-2-acetamido-3-[2-methyl-4-(trifluoromethyl)phenyl]prop-2-enoic acid |
| SMILES | CC(=O)N/C(=C/c1ccc(C(F)(F)F)cc1C)C(=O)O |
| InChI | InChI=1S/C13H12F3NO3/c1-7-5-10(13(14,15)16)4-3-9(7)6-11(12(19)20)17-8(2)18/h3-6H,1-2H3,(H,17,18)(H,19,20)/b11-6+ |
| InChIKey | TVGINHYOFWPMRA-IZZDOVSWSA-N |
| XLogP | 2.58 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|