C19H15F3N2O6 — CID 6209797
(E)-2-acetamido-3-[3-[[2-nitro-4-(trifluoromethyl)phenyl]methoxy]phenyl]prop-2-enoic acid (PubChem CID 6209797) has the molecular formula C19H15F3N2O6 and a molecular weight of 424.33 g/mol. Its IUPAC name is (E)-2-acetamido-3-[3-[[2-nitro-4-(trifluoromethyl)phenyl]methoxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-2-acetamido-3-[3-[[2-nitro-4-(trifluoromethyl)phenyl]methoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 6209797 |
| Molecular Formula | C19H15F3N2O6 |
| Molecular Weight | 424.33 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | (E)-2-acetamido-3-[3-[[2-nitro-4-(trifluoromethyl)phenyl]methoxy]phenyl]prop-2-enoic acid |
| SMILES | CC(=O)N/C(=C/c1cccc(OCc2ccc(C(F)(F)F)cc2[N+](=O)[O-])c1)C(=O)O |
| InChI | InChI=1S/C19H15F3N2O6/c1-11(25)23-16(18(26)27)8-12-3-2-4-15(7-12)30-10-13-5-6-14(19(20,21)22)9-17(13)24(28)29/h2-9H,10H2,1H3,(H,23,25)(H,26,27)/b16-8+ |
| InChIKey | AAQUWYZEFSRBRE-LZYBPNLTSA-N |
| XLogP | 3.75 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.33 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|