C25H21N3O9 — CID 4769155
2-benzamido-3-[4-[(2,4-dinitrophenyl)methoxy]-3-ethoxyphenyl]prop-2-enoic acid (PubChem CID 4769155) has the molecular formula C25H21N3O9 and a molecular weight of 507.46 g/mol. Its IUPAC name is 2-benzamido-3-[4-[(2,4-dinitrophenyl)methoxy]-3-ethoxyphenyl]prop-2-enoic acid.
| Compound Name | 2-benzamido-3-[4-[(2,4-dinitrophenyl)methoxy]-3-ethoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 4769155 |
| Molecular Formula | C25H21N3O9 |
| Molecular Weight | 507.46 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | 2-benzamido-3-[4-[(2,4-dinitrophenyl)methoxy]-3-ethoxyphenyl]prop-2-enoic acid |
| SMILES | CCOc1cc(C=C(NC(=O)c2ccccc2)C(=O)O)ccc1OCc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H21N3O9/c1-2-36-23-13-16(12-20(25(30)31)26-24(29)17-6-4-3-5-7-17)8-11-22(23)37-15-18-9-10-19(27(32)33)14-21(18)28(34)35/h3-14H,2,15H2,1H3,(H,26,29)(H,30,31) |
| InChIKey | FUZIIHWBSGEHLE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 171.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|