C11H8F3NO3 — CID 113458160
(E)-2-acetamido-3-(2,3,4-trifluorophenyl)prop-2-enoic acid (PubChem CID 113458160) has the molecular formula C11H8F3NO3 and a molecular weight of 259.18 g/mol. Its IUPAC name is (E)-2-acetamido-3-(2,3,4-trifluorophenyl)prop-2-enoic acid.
| Compound Name | (E)-2-acetamido-3-(2,3,4-trifluorophenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 113458160 |
| Molecular Formula | C11H8F3NO3 |
| Molecular Weight | 259.18 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | (E)-2-acetamido-3-(2,3,4-trifluorophenyl)prop-2-enoic acid |
| SMILES | CC(=O)N/C(=C/c1ccc(F)c(F)c1F)C(=O)O |
| InChI | InChI=1S/C11H8F3NO3/c1-5(16)15-8(11(17)18)4-6-2-3-7(12)10(14)9(6)13/h2-4H,1H3,(H,15,16)(H,17,18)/b8-4+ |
| InChIKey | KOOURSLEOCXHBE-XBXARRHUSA-N |
| XLogP | 1.67 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.18 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|