About [(Z)-1-carboxy-2-(2,3,4-trifluorophenyl)ethenyl]imino-iminoazanium
[(Z)-1-carboxy-2-(2,3,4-trifluorophenyl)ethenyl]imino-iminoazanium (PubChem CID 130408752) has the molecular formula C9H5F3N3O2+
and a molecular weight of 244.15 g/mol. Its IUPAC name is [(Z)-1-carboxy-2-(2,3,4-trifluorophenyl)ethenyl]imino-iminoazanium.
Molecular Properties
| Compound Name | [(Z)-1-carboxy-2-(2,3,4-trifluorophenyl)ethenyl]imino-iminoazanium |
| PubChem CID | 130408752 |
| Molecular Formula | C9H5F3N3O2+ |
| Molecular Weight | 244.15 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | [(Z)-1-carboxy-2-(2,3,4-trifluorophenyl)ethenyl]imino-iminoazanium |
| SMILES | N=[N+]=N/C(=C\c1ccc(F)c(F)c1F)C(=O)O |
| InChI | InChI=1S/C9H4F3N3O2/c10-5-2-1-4(7(11)8(5)12)3-6(9(16)17)14-15-13/h1-3,13H/p+1/b6-3- |
| InChIKey | XGUIXMDEWOIFJS-UTCJRWHESA-O |
| XLogP | 2.08 |
| TPSA | 87.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.15 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-1-carboxy-2-(2,3,4-trifluorophenyl)ethenyl]imino-iminoazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-1-carboxy-2-(2,3,4-trifluorophenyl)ethenyl]imino-iminoazanium?
The IUPAC name of [(Z)-1-carboxy-2-(2,3,4-trifluorophenyl)ethenyl]imino-iminoazanium (CID 130408752) is [(Z)-1-carboxy-2-(2,3,4-trifluorophenyl)ethenyl]imino-iminoazanium.
What is the SMILES notation for [(Z)-1-carboxy-2-(2,3,4-trifluorophenyl)ethenyl]imino-iminoazanium?
The canonical SMILES for [(Z)-1-carboxy-2-(2,3,4-trifluorophenyl)ethenyl]imino-iminoazanium is N=[N+]=N/C(=C\c1ccc(F)c(F)c1F)C(=O)O.
What is the InChIKey of [(Z)-1-carboxy-2-(2,3,4-trifluorophenyl)ethenyl]imino-iminoazanium?
The InChIKey is XGUIXMDEWOIFJS-UTCJRWHESA-O. The full InChI is InChI=1S/C9H4F3N3O2/c10-5-2-1-4(7(11)8(5)12)3-6(9(16)17)14-15-13/h1-3,13H/p+1/b6-3-.
What are the key properties of [(Z)-1-carboxy-2-(2,3,4-trifluorophenyl)ethenyl]imino-iminoazanium?
[(Z)-1-carboxy-2-(2,3,4-trifluorophenyl)ethenyl]imino-iminoazanium has a molecular weight of 244.15 g/mol, XLogP of 2.08, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-1-carboxy-2-(2,3,4-trifluorophenyl)ethenyl]imino-iminoazanium is sourced from PubChem (CID 130408752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).