C9H5F3N3O2+ — CID 130408752
[(Z)-1-carboxy-2-(2,3,4-trifluorophenyl)ethenyl]imino-iminoazanium (PubChem CID 130408752) has the molecular formula C9H5F3N3O2+ and a molecular weight of 244.15 g/mol. Its IUPAC name is [(Z)-1-carboxy-2-(2,3,4-trifluorophenyl)ethenyl]imino-iminoazanium.
| Compound Name | [(Z)-1-carboxy-2-(2,3,4-trifluorophenyl)ethenyl]imino-iminoazanium |
|---|---|
| PubChem CID | 130408752 |
| Molecular Formula | C9H5F3N3O2+ |
| Molecular Weight | 244.15 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | [(Z)-1-carboxy-2-(2,3,4-trifluorophenyl)ethenyl]imino-iminoazanium |
| SMILES | N=[N+]=N/C(=C\c1ccc(F)c(F)c1F)C(=O)O |
| InChI | InChI=1S/C9H4F3N3O2/c10-5-2-1-4(7(11)8(5)12)3-6(9(16)17)14-15-13/h1-3,13H/p+1/b6-3- |
| InChIKey | XGUIXMDEWOIFJS-UTCJRWHESA-O |
| XLogP | 2.08 |
| TPSA | 87.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.15 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|