C10H7F3O2 — CID 170483379
4-(2,3,4-trifluorophenyl)but-3-enoic acid (PubChem CID 170483379) has the molecular formula C10H7F3O2 and a molecular weight of 216.16 g/mol. Its IUPAC name is 4-(2,3,4-trifluorophenyl)but-3-enoic acid.
| Compound Name | 4-(2,3,4-trifluorophenyl)but-3-enoic acid |
|---|---|
| PubChem CID | 170483379 |
| Molecular Formula | C10H7F3O2 |
| Molecular Weight | 216.16 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 4-(2,3,4-trifluorophenyl)but-3-enoic acid |
| SMILES | O=C(O)CC=Cc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C10H7F3O2/c11-7-5-4-6(9(12)10(7)13)2-1-3-8(14)15/h1-2,4-5H,3H2,(H,14,15) |
| InChIKey | NMBLBABXGMBEFZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.16 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|