4-(4-amino-2,3-difluorophenyl)but-3-enoic acid

C10H9F2NO2 — CID 170483621

IUPAC4-(4-amino-2,3-difluorophenyl)but-3-enoic acid
SMILESNc1ccc(C=CCC(=O)O)c(F)c1F
InChIInChI=1S/C10H9F2NO2/c11-9-6(2-1-3-8(14)15)4-5-7(13)10(9)12/h1-2,4-5H,3,13H2,(H,14,15)
InChIKeyZZVBKDQDHYTPSP-UHFFFAOYSA-N
MW213.18 g/mol
LogP2.03
Rot. Bonds3

About 4-(4-amino-2,3-difluorophenyl)but-3-enoic acid

4-(4-amino-2,3-difluorophenyl)but-3-enoic acid (PubChem CID 170483621) has the molecular formula C10H9F2NO2 and a molecular weight of 213.18 g/mol. Its IUPAC name is 4-(4-amino-2,3-difluorophenyl)but-3-enoic acid.

Molecular Properties

Compound Name4-(4-amino-2,3-difluorophenyl)but-3-enoic acid
PubChem CID170483621
Molecular FormulaC10H9F2NO2
Molecular Weight213.18 g/mol
Exact Mass213.06
IUPAC Name4-(4-amino-2,3-difluorophenyl)but-3-enoic acid
SMILESNc1ccc(C=CCC(=O)O)c(F)c1F
InChIInChI=1S/C10H9F2NO2/c11-9-6(2-1-3-8(14)15)4-5-7(13)10(9)12/h1-2,4-5H,3,13H2,(H,14,15)
InChIKeyZZVBKDQDHYTPSP-UHFFFAOYSA-N
XLogP2.03
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.18
LogP ≤ 52.03
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 4-(4-amino-2,3-difluorophenyl)but-3-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(4-amino-2,3-difluorophenyl)but-3-enoic acid?
The IUPAC name of 4-(4-amino-2,3-difluorophenyl)but-3-enoic acid (CID 170483621) is 4-(4-amino-2,3-difluorophenyl)but-3-enoic acid.
What is the SMILES notation for 4-(4-amino-2,3-difluorophenyl)but-3-enoic acid?
The canonical SMILES for 4-(4-amino-2,3-difluorophenyl)but-3-enoic acid is Nc1ccc(C=CCC(=O)O)c(F)c1F.
What is the InChIKey of 4-(4-amino-2,3-difluorophenyl)but-3-enoic acid?
The InChIKey is ZZVBKDQDHYTPSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F2NO2/c11-9-6(2-1-3-8(14)15)4-5-7(13)10(9)12/h1-2,4-5H,3,13H2,(H,14,15).
What are the key properties of 4-(4-amino-2,3-difluorophenyl)but-3-enoic acid?
4-(4-amino-2,3-difluorophenyl)but-3-enoic acid has a molecular weight of 213.18 g/mol, XLogP of 2.03, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-amino-2,3-difluorophenyl)but-3-enoic acid is sourced from PubChem (CID 170483621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).