C9H8ClF2N — CID 169477392
4-(3-chloroprop-1-enyl)-2,3-difluoroaniline (PubChem CID 169477392) has the molecular formula C9H8ClF2N and a molecular weight of 203.62 g/mol. Its IUPAC name is 4-(3-chloroprop-1-enyl)-2,3-difluoroaniline.
| Compound Name | 4-(3-chloroprop-1-enyl)-2,3-difluoroaniline |
|---|---|
| PubChem CID | 169477392 |
| Molecular Formula | C9H8ClF2N |
| Molecular Weight | 203.62 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 4-(3-chloroprop-1-enyl)-2,3-difluoroaniline |
| SMILES | Nc1ccc(C=CCCl)c(F)c1F |
| InChI | InChI=1S/C9H8ClF2N/c10-5-1-2-6-3-4-7(13)9(12)8(6)11/h1-4H,5,13H2 |
| InChIKey | PGRMXRPCFWQOPA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.62 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|