About 4-(3-chloroprop-1-enyl)-2,3-difluoroaniline
4-(3-chloroprop-1-enyl)-2,3-difluoroaniline (PubChem CID 169477392) has the molecular formula C9H8ClF2N
and a molecular weight of 203.62 g/mol. Its IUPAC name is 4-(3-chloroprop-1-enyl)-2,3-difluoroaniline.
Molecular Properties
| Compound Name | 4-(3-chloroprop-1-enyl)-2,3-difluoroaniline |
| PubChem CID | 169477392 |
| Molecular Formula | C9H8ClF2N |
| Molecular Weight | 203.62 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 4-(3-chloroprop-1-enyl)-2,3-difluoroaniline |
| SMILES | Nc1ccc(C=CCCl)c(F)c1F |
| InChI | InChI=1S/C9H8ClF2N/c10-5-1-2-6-3-4-7(13)9(12)8(6)11/h1-4H,5,13H2 |
| InChIKey | PGRMXRPCFWQOPA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.62 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-chloroprop-1-enyl)-2,3-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-chloroprop-1-enyl)-2,3-difluoroaniline?
The IUPAC name of 4-(3-chloroprop-1-enyl)-2,3-difluoroaniline (CID 169477392) is 4-(3-chloroprop-1-enyl)-2,3-difluoroaniline.
What is the SMILES notation for 4-(3-chloroprop-1-enyl)-2,3-difluoroaniline?
The canonical SMILES for 4-(3-chloroprop-1-enyl)-2,3-difluoroaniline is Nc1ccc(C=CCCl)c(F)c1F.
What is the InChIKey of 4-(3-chloroprop-1-enyl)-2,3-difluoroaniline?
The InChIKey is PGRMXRPCFWQOPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClF2N/c10-5-1-2-6-3-4-7(13)9(12)8(6)11/h1-4H,5,13H2.
What are the key properties of 4-(3-chloroprop-1-enyl)-2,3-difluoroaniline?
4-(3-chloroprop-1-enyl)-2,3-difluoroaniline has a molecular weight of 203.62 g/mol, XLogP of 2.80, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-chloroprop-1-enyl)-2,3-difluoroaniline is sourced from PubChem (CID 169477392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).