C12H11F2NO3S — CID 104830856
(E)-2-acetamido-3-[4-(difluoromethylsulfanyl)phenyl]prop-2-enoic acid (PubChem CID 104830856) has the molecular formula C12H11F2NO3S and a molecular weight of 287.29 g/mol. Its IUPAC name is (E)-2-acetamido-3-[4-(difluoromethylsulfanyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-2-acetamido-3-[4-(difluoromethylsulfanyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 104830856 |
| Molecular Formula | C12H11F2NO3S |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | (E)-2-acetamido-3-[4-(difluoromethylsulfanyl)phenyl]prop-2-enoic acid |
| SMILES | CC(=O)N/C(=C/c1ccc(SC(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C12H11F2NO3S/c1-7(16)15-10(11(17)18)6-8-2-4-9(5-3-8)19-12(13)14/h2-6,12H,1H3,(H,15,16)(H,17,18)/b10-6+ |
| InChIKey | HEISYSIMOWETOK-UXBLZVDNSA-N |
| XLogP | 2.56 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|