C9H9NO3Se — CID 4071106
2-acetamido-3-selenophen-3-ylprop-2-enoic acid (PubChem CID 4071106) has the molecular formula C9H9NO3Se and a molecular weight of 258.13 g/mol. Its IUPAC name is 2-acetamido-3-selenophen-3-ylprop-2-enoic acid.
| Compound Name | 2-acetamido-3-selenophen-3-ylprop-2-enoic acid |
|---|---|
| PubChem CID | 4071106 |
| Molecular Formula | C9H9NO3Se |
| Molecular Weight | 258.13 g/mol |
| Exact Mass | 258.97 |
| IUPAC Name | 2-acetamido-3-selenophen-3-ylprop-2-enoic acid |
| SMILES | CC(=O)NC(=Cc1cc[se]c1)C(=O)O |
| InChI | InChI=1S/C9H9NO3Se/c1-6(11)10-8(9(12)13)4-7-2-3-14-5-7/h2-5H,1H3,(H,10,11)(H,12,13) |
| InChIKey | ZMZRBUBHIKLMRG-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.13 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|