C25H21F3N2O4 — CID 2369819
N,N'-bis(2-methoxyphenyl)-2-[[2-(trifluoromethyl)phenyl]methylidene]propanediamide (PubChem CID 2369819) has the molecular formula C25H21F3N2O4 and a molecular weight of 470.45 g/mol. Its IUPAC name is N,N'-bis(2-methoxyphenyl)-2-[[2-(trifluoromethyl)phenyl]methylidene]propanediamide.
| Compound Name | N,N'-bis(2-methoxyphenyl)-2-[[2-(trifluoromethyl)phenyl]methylidene]propanediamide |
|---|---|
| PubChem CID | 2369819 |
| Molecular Formula | C25H21F3N2O4 |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | N,N'-bis(2-methoxyphenyl)-2-[[2-(trifluoromethyl)phenyl]methylidene]propanediamide |
| SMILES | COc1ccccc1NC(=O)C(=Cc1ccccc1C(F)(F)F)C(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C25H21F3N2O4/c1-33-21-13-7-5-11-19(21)29-23(31)17(15-16-9-3-4-10-18(16)25(26,27)28)24(32)30-20-12-6-8-14-22(20)34-2/h3-15H,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | FZUBVUDUIVXHKB-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|