C27H28N2O4 — CID 2445487
N,N'-bis(2-methoxyphenyl)-2-[(4-propan-2-ylphenyl)methylidene]propanediamide (PubChem CID 2445487) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is N,N'-bis(2-methoxyphenyl)-2-[(4-propan-2-ylphenyl)methylidene]propanediamide.
| Compound Name | N,N'-bis(2-methoxyphenyl)-2-[(4-propan-2-ylphenyl)methylidene]propanediamide |
|---|---|
| PubChem CID | 2445487 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | N,N'-bis(2-methoxyphenyl)-2-[(4-propan-2-ylphenyl)methylidene]propanediamide |
| SMILES | COc1ccccc1NC(=O)C(=Cc1ccc(C(C)C)cc1)C(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C27H28N2O4/c1-18(2)20-15-13-19(14-16-20)17-21(26(30)28-22-9-5-7-11-24(22)32-3)27(31)29-23-10-6-8-12-25(23)33-4/h5-18H,1-4H3,(H,28,30)(H,29,31) |
| InChIKey | DJGCMSIKABNSRW-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|