C24H20Cl2N2O4 — CID 16554527
2-[(2,3-dichlorophenyl)methylidene]-N,N'-bis(2-methoxyphenyl)propanediamide (PubChem CID 16554527) has the molecular formula C24H20Cl2N2O4 and a molecular weight of 471.34 g/mol. Its IUPAC name is 2-[(2,3-dichlorophenyl)methylidene]-N,N'-bis(2-methoxyphenyl)propanediamide.
| Compound Name | 2-[(2,3-dichlorophenyl)methylidene]-N,N'-bis(2-methoxyphenyl)propanediamide |
|---|---|
| PubChem CID | 16554527 |
| Molecular Formula | C24H20Cl2N2O4 |
| Molecular Weight | 471.34 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | 2-[(2,3-dichlorophenyl)methylidene]-N,N'-bis(2-methoxyphenyl)propanediamide |
| SMILES | COc1ccccc1NC(=O)C(=Cc1cccc(Cl)c1Cl)C(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C24H20Cl2N2O4/c1-31-20-12-5-3-10-18(20)27-23(29)16(14-15-8-7-9-17(25)22(15)26)24(30)28-19-11-4-6-13-21(19)32-2/h3-14H,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | OFBKNRSVXHRRDF-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.34 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|