C15H18F3NO3S — CID 54196339
3-[2-(dimethylamino)ethylsulfonyl]-4-[2-(trifluoromethyl)phenyl]but-3-en-2-one (PubChem CID 54196339) has the molecular formula C15H18F3NO3S and a molecular weight of 349.37 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethylsulfonyl]-4-[2-(trifluoromethyl)phenyl]but-3-en-2-one.
| Compound Name | 3-[2-(dimethylamino)ethylsulfonyl]-4-[2-(trifluoromethyl)phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 54196339 |
| Molecular Formula | C15H18F3NO3S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 3-[2-(dimethylamino)ethylsulfonyl]-4-[2-(trifluoromethyl)phenyl]but-3-en-2-one |
| SMILES | CC(=O)C(=Cc1ccccc1C(F)(F)F)S(=O)(=O)CCN(C)C |
| InChI | InChI=1S/C15H18F3NO3S/c1-11(20)14(23(21,22)9-8-19(2)3)10-12-6-4-5-7-13(12)15(16,17)18/h4-7,10H,8-9H2,1-3H3 |
| InChIKey | PMBMZJNRVJRZDF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|