C12H14ClF4N3O2 — CID 70265356
(E)-3-[2-fluoro-6-(trifluoromethyl)phenyl]-2-methylprop-2-enoic acid;guanidine;hydrochloride (PubChem CID 70265356) has the molecular formula C12H14ClF4N3O2 and a molecular weight of 343.71 g/mol. Its IUPAC name is (E)-3-[2-fluoro-6-(trifluoromethyl)phenyl]-2-methylprop-2-enoic acid;guanidine;hydrochloride.
| Compound Name | (E)-3-[2-fluoro-6-(trifluoromethyl)phenyl]-2-methylprop-2-enoic acid;guanidine;hydrochloride |
|---|---|
| PubChem CID | 70265356 |
| Molecular Formula | C12H14ClF4N3O2 |
| Molecular Weight | 343.71 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | (E)-3-[2-fluoro-6-(trifluoromethyl)phenyl]-2-methylprop-2-enoic acid;guanidine;hydrochloride |
| SMILES | C/C(=C\c1c(F)cccc1C(F)(F)F)C(=O)O.Cl.[H]N=C(N)N |
| InChI | InChI=1S/C11H8F4O2.CH5N3.ClH/c1-6(10(16)17)5-7-8(11(13,14)15)3-2-4-9(7)12;2-1(3)4;/h2-5H,1H3,(H,16,17);(H5,2,3,4);1H/b6-5+;; |
| InChIKey | PZXBWYXMYGGWHK-TXOOBNKBSA-N |
| XLogP | 2.59 |
| TPSA | 113.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.71 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|