C11H7F5O2 — CID 170873401
(E)-3-[4,5-difluoro-2-(trifluoromethyl)phenyl]-2-methylprop-2-enoic acid (PubChem CID 170873401) has the molecular formula C11H7F5O2 and a molecular weight of 266.17 g/mol. Its IUPAC name is (E)-3-[4,5-difluoro-2-(trifluoromethyl)phenyl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[4,5-difluoro-2-(trifluoromethyl)phenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 170873401 |
| Molecular Formula | C11H7F5O2 |
| Molecular Weight | 266.17 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | (E)-3-[4,5-difluoro-2-(trifluoromethyl)phenyl]-2-methylprop-2-enoic acid |
| SMILES | C/C(=C\c1cc(F)c(F)cc1C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C11H7F5O2/c1-5(10(17)18)2-6-3-8(12)9(13)4-7(6)11(14,15)16/h2-4H,1H3,(H,17,18)/b5-2+ |
| InChIKey | IHCDOJCAOBDKFR-GORDUTHDSA-N |
| XLogP | 3.47 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.17 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|