About ethene;furan-2,5-dione;methyl 2-methylprop-2-enoate
ethene;furan-2,5-dione;methyl 2-methylprop-2-enoate (PubChem CID 86747682) has the molecular formula C11H14O5
and a molecular weight of 226.23 g/mol. Its IUPAC name is ethene;furan-2,5-dione;methyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | ethene;furan-2,5-dione;methyl 2-methylprop-2-enoate |
| PubChem CID | 86747682 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | ethene;furan-2,5-dione;methyl 2-methylprop-2-enoate |
| SMILES | C=C.C=C(C)C(=O)OC.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C5H8O2.C4H2O3.C2H4/c1-4(2)5(6)7-3;5-3-1-2-4(6)7-3;1-2/h1H2,2-3H3;1-2H;1-2H2 |
| InChIKey | SKKHUNFMYYTBHJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethene;furan-2,5-dione;methyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;furan-2,5-dione;methyl 2-methylprop-2-enoate?
The IUPAC name of ethene;furan-2,5-dione;methyl 2-methylprop-2-enoate (CID 86747682) is ethene;furan-2,5-dione;methyl 2-methylprop-2-enoate.
What is the SMILES notation for ethene;furan-2,5-dione;methyl 2-methylprop-2-enoate?
The canonical SMILES for ethene;furan-2,5-dione;methyl 2-methylprop-2-enoate is C=C.C=C(C)C(=O)OC.O=C1C=CC(=O)O1.
What is the InChIKey of ethene;furan-2,5-dione;methyl 2-methylprop-2-enoate?
The InChIKey is SKKHUNFMYYTBHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.C4H2O3.C2H4/c1-4(2)5(6)7-3;5-3-1-2-4(6)7-3;1-2/h1H2,2-3H3;1-2H;1-2H2.
What are the key properties of ethene;furan-2,5-dione;methyl 2-methylprop-2-enoate?
ethene;furan-2,5-dione;methyl 2-methylprop-2-enoate has a molecular weight of 226.23 g/mol, XLogP of 1.16, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;furan-2,5-dione;methyl 2-methylprop-2-enoate is sourced from PubChem (CID 86747682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).