About methyl 3-(3-chloro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoate
methyl 3-(3-chloro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoate (PubChem CID 74411712) has the molecular formula C15H11ClO4
and a molecular weight of 290.70 g/mol. Its IUPAC name is methyl 3-(3-chloro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoate.
Molecular Properties
| Compound Name | methyl 3-(3-chloro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoate |
| PubChem CID | 74411712 |
| Molecular Formula | C15H11ClO4 |
| Molecular Weight | 290.70 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | methyl 3-(3-chloro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoate |
| SMILES | COC(=O)C(C)=CC1=C(Cl)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H11ClO4/c1-8(15(19)20-2)7-11-12(16)14(18)10-6-4-3-5-9(10)13(11)17/h3-7H,1-2H3 |
| InChIKey | IJIKMURROBTGLA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.70 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(3-chloro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(3-chloro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoate?
The IUPAC name of methyl 3-(3-chloro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoate (CID 74411712) is methyl 3-(3-chloro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoate.
What is the SMILES notation for methyl 3-(3-chloro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoate?
The canonical SMILES for methyl 3-(3-chloro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoate is COC(=O)C(C)=CC1=C(Cl)C(=O)c2ccccc2C1=O.
What is the InChIKey of methyl 3-(3-chloro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoate?
The InChIKey is IJIKMURROBTGLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11ClO4/c1-8(15(19)20-2)7-11-12(16)14(18)10-6-4-3-5-9(10)13(11)17/h3-7H,1-2H3.
What are the key properties of methyl 3-(3-chloro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoate?
methyl 3-(3-chloro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoate has a molecular weight of 290.70 g/mol, XLogP of 2.68, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3-chloro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoate is sourced from PubChem (CID 74411712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).