C13H24N2O4 — CID 160973197
1-methoxycyclobutane-1-carboxamide;1-methoxy-N-methylcyclobutane-1-carboxamide (PubChem CID 160973197) has the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. Its IUPAC name is 1-methoxycyclobutane-1-carboxamide;1-methoxy-N-methylcyclobutane-1-carboxamide.
| Compound Name | 1-methoxycyclobutane-1-carboxamide;1-methoxy-N-methylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 160973197 |
| Molecular Formula | C13H24N2O4 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 1-methoxycyclobutane-1-carboxamide;1-methoxy-N-methylcyclobutane-1-carboxamide |
| SMILES | CNC(=O)C1(OC)CCC1.COC1(C(N)=O)CCC1 |
| InChI | InChI=1S/C7H13NO2.C6H11NO2/c1-8-6(9)7(10-2)4-3-5-7;1-9-6(5(7)8)3-2-4-6/h3-5H2,1-2H3,(H,8,9);2-4H2,1H3,(H2,7,8) |
| InChIKey | SYNIYJOQJHQGSE-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |