C6H12N2O2 — CID 142554999
3-amino-1-methoxycyclobutane-1-carboxamide (PubChem CID 142554999) has the molecular formula C6H12N2O2 and a molecular weight of 144.17 g/mol. Its IUPAC name is 3-amino-1-methoxycyclobutane-1-carboxamide.
| Compound Name | 3-amino-1-methoxycyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 142554999 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | 3-amino-1-methoxycyclobutane-1-carboxamide |
| SMILES | COC1(C(N)=O)CC(N)C1 |
| InChI | InChI=1S/C6H12N2O2/c1-10-6(5(8)9)2-4(7)3-6/h4H,2-3,7H2,1H3,(H2,8,9) |
| InChIKey | ZSXCNCAFWCSTDP-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |