C25H27FN4O4 — CID 140817779
3,3,4,4,5-pentadeuterio-5-[1,1-dideuterio-7-[[2-fluoro-4-(morpholin-4-ylmethyl)phenyl]methylamino]-3-oxoisoindol-2-yl]piperidine-2,6-dione (PubChem CID 140817779) has the molecular formula C25H27FN4O4 and a molecular weight of 473.56 g/mol. Its IUPAC name is 3,3,4,4,5-pentadeuterio-5-[1,1-dideuterio-7-[[2-fluoro-4-(morpholin-4-ylmethyl)phenyl]methylamino]-3-oxoisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3,3,4,4,5-pentadeuterio-5-[1,1-dideuterio-7-[[2-fluoro-4-(morpholin-4-ylmethyl)phenyl]methylamino]-3-oxoisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 140817779 |
| Molecular Formula | C25H27FN4O4 |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | 3,3,4,4,5-pentadeuterio-5-[1,1-dideuterio-7-[[2-fluoro-4-(morpholin-4-ylmethyl)phenyl]methylamino]-3-oxoisoindol-2-yl]piperidine-2,6-dione |
| SMILES | [2H]C1([2H])c2c(NCc3ccc(CN4CCOCC4)cc3F)cccc2C(=O)N1C1([2H])C(=O)NC(=O)C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C25H27FN4O4/c26-20-12-16(14-29-8-10-34-11-9-29)4-5-17(20)13-27-21-3-1-2-18-19(21)15-30(25(18)33)22-6-7-23(31)28-24(22)32/h1-5,12,22,27H,6-11,13-15H2,(H,28,31,32)/i6D2,7D2,15D2,22D |
| InChIKey | BLFGUOVIPZONGE-JWFXECGESA-N |
| XLogP | 2.03 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|