C25H26FN3O5 — CID 153447270
(5R)-3,3,4,4,5-pentadeuterio-5-[1,1-dideuterio-7-[dideuterio-[4-[dideuterio(morpholin-4-yl)methyl]-2-fluorophenyl]methoxy]-3-oxoisoindol-2-yl]piperidine-2,6-dione (PubChem CID 153447270) has the molecular formula C25H26FN3O5 and a molecular weight of 478.56 g/mol. Its IUPAC name is (5R)-3,3,4,4,5-pentadeuterio-5-[1,1-dideuterio-7-[dideuterio-[4-[dideuterio(morpholin-4-yl)methyl]-2-fluorophenyl]methoxy]-3-oxoisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | (5R)-3,3,4,4,5-pentadeuterio-5-[1,1-dideuterio-7-[dideuterio-[4-[dideuterio(morpholin-4-yl)methyl]-2-fluorophenyl]methoxy]-3-oxoisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 153447270 |
| Molecular Formula | C25H26FN3O5 |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | (5R)-3,3,4,4,5-pentadeuterio-5-[1,1-dideuterio-7-[dideuterio-[4-[dideuterio(morpholin-4-yl)methyl]-2-fluorophenyl]methoxy]-3-oxoisoindol-2-yl]piperidine-2,6-dione |
| SMILES | [2H]C([2H])(Oc1cccc2c1C([2H])([2H])N([C@@]1([2H])C(=O)NC(=O)C([2H])([2H])C1([2H])[2H])C2=O)c1ccc(C([2H])([2H])N2CCOCC2)cc1F |
| InChI | InChI=1S/C25H26FN3O5/c26-20-12-16(13-28-8-10-33-11-9-28)4-5-17(20)15-34-22-3-1-2-18-19(22)14-29(25(18)32)21-6-7-23(30)27-24(21)31/h1-5,12,21H,6-11,13-15H2,(H,27,30,31)/t21-/m1/s1/i6D2,7D2,13D2,14D2,15D2,21D |
| InChIKey | LSWTTWZVLFJNEN-QMPYNTADSA-N |
| XLogP | 2.00 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|