C22H24FN3O3 — CID 145070669
2-[7-[(2-fluoro-4-hydroxyphenyl)methylamino]-3-methylidene-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide (PubChem CID 145070669) has the molecular formula C22H24FN3O3 and a molecular weight of 397.45 g/mol. Its IUPAC name is 2-[7-[(2-fluoro-4-hydroxyphenyl)methylamino]-3-methylidene-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide.
| Compound Name | 2-[7-[(2-fluoro-4-hydroxyphenyl)methylamino]-3-methylidene-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 145070669 |
| Molecular Formula | C22H24FN3O3 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 2-[7-[(2-fluoro-4-hydroxyphenyl)methylamino]-3-methylidene-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide |
| SMILES | C=C1c2cccc(NCc3ccc(O)cc3F)c2CN1C(CCC=O)C(=O)NC |
| InChI | InChI=1S/C22H24FN3O3/c1-14-17-5-3-6-20(25-12-15-8-9-16(28)11-19(15)23)18(17)13-26(14)21(7-4-10-27)22(29)24-2/h3,5-6,8-11,21,25,28H,1,4,7,12-13H2,2H3,(H,24,29) |
| InChIKey | SIAVDCNIFNZBTE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|