C25H29N5O4 — CID 176972065
4-[5-[amino-[(Z)-2-amino-2-(2-cyclopropyloxyphenyl)ethenyl]amino]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide (PubChem CID 176972065) has the molecular formula C25H29N5O4 and a molecular weight of 463.54 g/mol. Its IUPAC name is 4-[5-[amino-[(Z)-2-amino-2-(2-cyclopropyloxyphenyl)ethenyl]amino]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide.
| Compound Name | 4-[5-[amino-[(Z)-2-amino-2-(2-cyclopropyloxyphenyl)ethenyl]amino]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 176972065 |
| Molecular Formula | C25H29N5O4 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 4-[5-[amino-[(Z)-2-amino-2-(2-cyclopropyloxyphenyl)ethenyl]amino]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)CCC(C=O)N1Cc2ccc(N(N)/C=C(\N)c3ccccc3OC3CC3)cc2C1=O |
| InChI | InChI=1S/C25H29N5O4/c1-28-24(32)11-8-18(15-31)29-13-16-6-7-17(12-21(16)25(29)33)30(27)14-22(26)20-4-2-3-5-23(20)34-19-9-10-19/h2-7,12,14-15,18-19H,8-11,13,26-27H2,1H3,(H,28,32)/b22-14- |
| InChIKey | VMKLBQOXMWGTSZ-HMAPJEAMSA-N |
| XLogP | 1.91 |
| TPSA | 130.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|