C27H30FN3O5 — CID 140817906
3,3,4,4-tetradeuterio-5-[7-[[3-[(2,6-dimethylmorpholin-4-yl)methyl]-2-fluorophenyl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 140817906) has the molecular formula C27H30FN3O5 and a molecular weight of 499.58 g/mol. Its IUPAC name is 3,3,4,4-tetradeuterio-5-[7-[[3-[(2,6-dimethylmorpholin-4-yl)methyl]-2-fluorophenyl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3,3,4,4-tetradeuterio-5-[7-[[3-[(2,6-dimethylmorpholin-4-yl)methyl]-2-fluorophenyl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 140817906 |
| Molecular Formula | C27H30FN3O5 |
| Molecular Weight | 499.58 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | 3,3,4,4-tetradeuterio-5-[7-[[3-[(2,6-dimethylmorpholin-4-yl)methyl]-2-fluorophenyl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | [2H]C1([2H])C(=O)NC(=O)C(N2Cc3c(OCc4cccc(CN5CC(C)OC(C)C5)c4F)cccc3C2=O)C1([2H])[2H] |
| InChI | InChI=1S/C27H30FN3O5/c1-16-11-30(12-17(2)36-16)13-18-5-3-6-19(25(18)28)15-35-23-8-4-7-20-21(23)14-31(27(20)34)22-9-10-24(32)29-26(22)33/h3-8,16-17,22H,9-15H2,1-2H3,(H,29,32,33)/i9D2,10D2 |
| InChIKey | QRLLXHTZCIDQGZ-YQUBHJMPSA-N |
| XLogP | 2.77 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.58 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|