C27H30FN5O4 — CID 166797562
(3R)-3-[7-[[3-[(2,6-dimethylmorpholin-4-yl)methyl]-2-fluorophenyl]methylamino]-3-oxo-1H-isoindol-2-yl]-4-iminopiperidine-2,6-dione (PubChem CID 166797562) has the molecular formula C27H30FN5O4 and a molecular weight of 507.57 g/mol. Its IUPAC name is (3R)-3-[7-[[3-[(2,6-dimethylmorpholin-4-yl)methyl]-2-fluorophenyl]methylamino]-3-oxo-1H-isoindol-2-yl]-4-iminopiperidine-2,6-dione.
| Compound Name | (3R)-3-[7-[[3-[(2,6-dimethylmorpholin-4-yl)methyl]-2-fluorophenyl]methylamino]-3-oxo-1H-isoindol-2-yl]-4-iminopiperidine-2,6-dione |
|---|---|
| PubChem CID | 166797562 |
| Molecular Formula | C27H30FN5O4 |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | (3R)-3-[7-[[3-[(2,6-dimethylmorpholin-4-yl)methyl]-2-fluorophenyl]methylamino]-3-oxo-1H-isoindol-2-yl]-4-iminopiperidine-2,6-dione |
| SMILES | [H]/N=C1\CC(=O)NC(=O)[C@@H]1N1Cc2c(NCc3cccc(CN4CC(C)OC(C)C4)c3F)cccc2C1=O |
| InChI | InChI=1S/C27H30FN5O4/c1-15-11-32(12-16(2)37-15)13-18-6-3-5-17(24(18)28)10-30-22-8-4-7-19-20(22)14-33(27(19)36)25-21(29)9-23(34)31-26(25)35/h3-8,15-16,25,29-30H,9-14H2,1-2H3,(H,31,34,35)/b29-21+/t15?,16?,25-/m1/s1 |
| InChIKey | LBZZFAYPISCCSN-XVCIEFMPSA-N |
| XLogP | 2.44 |
| TPSA | 114.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|