C20H24ClN3O4 — CID 171641289
2-[7-chloro-6-(4-formylpiperidin-1-yl)-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide (PubChem CID 171641289) has the molecular formula C20H24ClN3O4 and a molecular weight of 405.88 g/mol. Its IUPAC name is 2-[7-chloro-6-(4-formylpiperidin-1-yl)-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide.
| Compound Name | 2-[7-chloro-6-(4-formylpiperidin-1-yl)-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 171641289 |
| Molecular Formula | C20H24ClN3O4 |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 2-[7-chloro-6-(4-formylpiperidin-1-yl)-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)C(CCC=O)N1Cc2c(ccc(N3CCC(C=O)CC3)c2Cl)C1=O |
| InChI | InChI=1S/C20H24ClN3O4/c1-22-19(27)17(3-2-10-25)24-11-15-14(20(24)28)4-5-16(18(15)21)23-8-6-13(12-26)7-9-23/h4-5,10,12-13,17H,2-3,6-9,11H2,1H3,(H,22,27) |
| InChIKey | NIEBSQHJUQYCBZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|