C13H15N5O5 — CID 123438614
4-amino-2-(5,5-diamino-4,4-dihydroxy-2-oxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 123438614) has the molecular formula C13H15N5O5 and a molecular weight of 321.29 g/mol. Its IUPAC name is 4-amino-2-(5,5-diamino-4,4-dihydroxy-2-oxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-amino-2-(5,5-diamino-4,4-dihydroxy-2-oxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 123438614 |
| Molecular Formula | C13H15N5O5 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 4-amino-2-(5,5-diamino-4,4-dihydroxy-2-oxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | Nc1cccc2c1C(=O)N(C1C(=O)NCC(N)(N)C1(O)O)C2=O |
| InChI | InChI=1S/C13H15N5O5/c14-6-3-1-2-5-7(6)11(21)18(10(5)20)8-9(19)17-4-12(15,16)13(8,22)23/h1-3,8,22-23H,4,14-16H2,(H,17,19) |
| InChIKey | HYXOQSILPSGHII-UHFFFAOYSA-N |
| XLogP | -3.34 |
| TPSA | 185.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | -3.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|