About 4-amino-2-(4,4-dimethylcycloheptyl)isoindole-1,3-dione
4-amino-2-(4,4-dimethylcycloheptyl)isoindole-1,3-dione (PubChem CID 65084134) has the molecular formula C17H22N2O2
and a molecular weight of 286.37 g/mol. Its IUPAC name is 4-amino-2-(4,4-dimethylcycloheptyl)isoindole-1,3-dione.
Molecular Properties
| Compound Name | 4-amino-2-(4,4-dimethylcycloheptyl)isoindole-1,3-dione |
| PubChem CID | 65084134 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 4-amino-2-(4,4-dimethylcycloheptyl)isoindole-1,3-dione |
| SMILES | CC1(C)CCCC(N2C(=O)c3cccc(N)c3C2=O)CC1 |
| InChI | InChI=1S/C17H22N2O2/c1-17(2)9-4-5-11(8-10-17)19-15(20)12-6-3-7-13(18)14(12)16(19)21/h3,6-7,11H,4-5,8-10,18H2,1-2H3 |
| InChIKey | RLTWLJDEQGOYIF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2-(4,4-dimethylcycloheptyl)isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-(4,4-dimethylcycloheptyl)isoindole-1,3-dione?
The IUPAC name of 4-amino-2-(4,4-dimethylcycloheptyl)isoindole-1,3-dione (CID 65084134) is 4-amino-2-(4,4-dimethylcycloheptyl)isoindole-1,3-dione.
What is the SMILES notation for 4-amino-2-(4,4-dimethylcycloheptyl)isoindole-1,3-dione?
The canonical SMILES for 4-amino-2-(4,4-dimethylcycloheptyl)isoindole-1,3-dione is CC1(C)CCCC(N2C(=O)c3cccc(N)c3C2=O)CC1.
What is the InChIKey of 4-amino-2-(4,4-dimethylcycloheptyl)isoindole-1,3-dione?
The InChIKey is RLTWLJDEQGOYIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O2/c1-17(2)9-4-5-11(8-10-17)19-15(20)12-6-3-7-13(18)14(12)16(19)21/h3,6-7,11H,4-5,8-10,18H2,1-2H3.
What are the key properties of 4-amino-2-(4,4-dimethylcycloheptyl)isoindole-1,3-dione?
4-amino-2-(4,4-dimethylcycloheptyl)isoindole-1,3-dione has a molecular weight of 286.37 g/mol, XLogP of 3.22, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-(4,4-dimethylcycloheptyl)isoindole-1,3-dione is sourced from PubChem (CID 65084134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).