C18H22N4O3 — CID 178083171
4-amino-2-[(3S)-1-(pyrrolidine-1-carbonyl)piperidin-3-yl]isoindole-1,3-dione (PubChem CID 178083171) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 4-amino-2-[(3S)-1-(pyrrolidine-1-carbonyl)piperidin-3-yl]isoindole-1,3-dione.
| Compound Name | 4-amino-2-[(3S)-1-(pyrrolidine-1-carbonyl)piperidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 178083171 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 4-amino-2-[(3S)-1-(pyrrolidine-1-carbonyl)piperidin-3-yl]isoindole-1,3-dione |
| SMILES | Nc1cccc2c1C(=O)N([C@H]1CCCN(C(=O)N3CCCC3)C1)C2=O |
| InChI | InChI=1S/C18H22N4O3/c19-14-7-3-6-13-15(14)17(24)22(16(13)23)12-5-4-10-21(11-12)18(25)20-8-1-2-9-20/h3,6-7,12H,1-2,4-5,8-11,19H2/t12-/m0/s1 |
| InChIKey | PCHLFTFNAICBAS-LBPRGKRZSA-N |
| XLogP | 1.54 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|