C15H19N3O4 — CID 178083167
4-amino-2-[(3R)-1-[hydroxy(methoxy)methyl]piperidin-3-yl]isoindole-1,3-dione (PubChem CID 178083167) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is 4-amino-2-[(3R)-1-[hydroxy(methoxy)methyl]piperidin-3-yl]isoindole-1,3-dione.
| Compound Name | 4-amino-2-[(3R)-1-[hydroxy(methoxy)methyl]piperidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 178083167 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 4-amino-2-[(3R)-1-[hydroxy(methoxy)methyl]piperidin-3-yl]isoindole-1,3-dione |
| SMILES | COC(O)N1CCC[C@@H](N2C(=O)c3cccc(N)c3C2=O)C1 |
| InChI | InChI=1S/C15H19N3O4/c1-22-15(21)17-7-3-4-9(8-17)18-13(19)10-5-2-6-11(16)12(10)14(18)20/h2,5-6,9,15,21H,3-4,7-8,16H2,1H3/t9-,15?/m1/s1 |
| InChIKey | YGCJNHGGOPMSOS-WXMRUQJCSA-N |
| XLogP | 0.25 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|