C15H17N3O4 — CID 145194146
4-amino-2-[(3S)-7-methoxy-2-oxoazepan-3-yl]isoindole-1,3-dione (PubChem CID 145194146) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is 4-amino-2-[(3S)-7-methoxy-2-oxoazepan-3-yl]isoindole-1,3-dione.
| Compound Name | 4-amino-2-[(3S)-7-methoxy-2-oxoazepan-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 145194146 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 4-amino-2-[(3S)-7-methoxy-2-oxoazepan-3-yl]isoindole-1,3-dione |
| SMILES | COC1CCC[C@H](N2C(=O)c3cccc(N)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C15H17N3O4/c1-22-11-7-3-6-10(13(19)17-11)18-14(20)8-4-2-5-9(16)12(8)15(18)21/h2,4-5,10-11H,3,6-7,16H2,1H3,(H,17,19)/t10-,11?/m0/s1 |
| InChIKey | KMBAUCFXXRXQBK-VUWPPUDQSA-N |
| XLogP | 0.51 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|