C15H18N2O2 — CID 21405570
2-(1-ethylpiperidin-3-yl)isoindole-1,3-dione (PubChem CID 21405570) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-(1-ethylpiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 2-(1-ethylpiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 21405570 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 2-(1-ethylpiperidin-3-yl)isoindole-1,3-dione |
| SMILES | CCN1CCCC(N2C(=O)c3ccccc3C2=O)C1 |
| InChI | InChI=1S/C15H18N2O2/c1-2-16-9-5-6-11(10-16)17-14(18)12-7-3-4-8-13(12)15(17)19/h3-4,7-8,11H,2,5-6,9-10H2,1H3 |
| InChIKey | SCDNPOHVJJYTHG-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|