C20H17ClN2O4 — CID 113082863
4-chloro-2-[1-(4-methoxybenzoyl)pyrrolidin-3-yl]isoindole-1,3-dione (PubChem CID 113082863) has the molecular formula C20H17ClN2O4 and a molecular weight of 384.82 g/mol. Its IUPAC name is 4-chloro-2-[1-(4-methoxybenzoyl)pyrrolidin-3-yl]isoindole-1,3-dione.
| Compound Name | 4-chloro-2-[1-(4-methoxybenzoyl)pyrrolidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 113082863 |
| Molecular Formula | C20H17ClN2O4 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 4-chloro-2-[1-(4-methoxybenzoyl)pyrrolidin-3-yl]isoindole-1,3-dione |
| SMILES | COc1ccc(C(=O)N2CCC(N3C(=O)c4cccc(Cl)c4C3=O)C2)cc1 |
| InChI | InChI=1S/C20H17ClN2O4/c1-27-14-7-5-12(6-8-14)18(24)22-10-9-13(11-22)23-19(25)15-3-2-4-16(21)17(15)20(23)26/h2-8,13H,9-11H2,1H3 |
| InChIKey | QJVAWQVAEQOGFM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|