C18H18N4O2 — CID 178083138
4-amino-2-[(3R)-1-pyridin-2-ylpiperidin-3-yl]isoindole-1,3-dione (PubChem CID 178083138) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 4-amino-2-[(3R)-1-pyridin-2-ylpiperidin-3-yl]isoindole-1,3-dione.
| Compound Name | 4-amino-2-[(3R)-1-pyridin-2-ylpiperidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 178083138 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 4-amino-2-[(3R)-1-pyridin-2-ylpiperidin-3-yl]isoindole-1,3-dione |
| SMILES | Nc1cccc2c1C(=O)N([C@@H]1CCCN(c3ccccn3)C1)C2=O |
| InChI | InChI=1S/C18H18N4O2/c19-14-7-3-6-13-16(14)18(24)22(17(13)23)12-5-4-10-21(11-12)15-8-1-2-9-20-15/h1-3,6-9,12H,4-5,10-11,19H2/t12-/m1/s1 |
| InChIKey | RLSFVGSPICFEKR-GFCCVEGCSA-N |
| XLogP | 1.93 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|