C17H19NO3 — CID 10869868
(5E)-11-methyl-8-oxa-1-azatricyclo[9.7.0.012,17]octadeca-5,12,14,16-tetraene-9,18-dione (PubChem CID 10869868) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is (5E)-11-methyl-8-oxa-1-azatricyclo[9.7.0.012,17]octadeca-5,12,14,16-tetraene-9,18-dione.
| Compound Name | (5E)-11-methyl-8-oxa-1-azatricyclo[9.7.0.012,17]octadeca-5,12,14,16-tetraene-9,18-dione |
|---|---|
| PubChem CID | 10869868 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | (5E)-11-methyl-8-oxa-1-azatricyclo[9.7.0.012,17]octadeca-5,12,14,16-tetraene-9,18-dione |
| SMILES | CC12CC(=O)OC/C=C/CCCN1C(=O)c1ccccc12 |
| InChI | InChI=1S/C17H19NO3/c1-17-12-15(19)21-11-7-3-2-6-10-18(17)16(20)13-8-4-5-9-14(13)17/h3-5,7-9H,2,6,10-12H2,1H3/b7-3+ |
| InChIKey | TWZPLWYJTGARDG-XVNBXDOJSA-N |
| XLogP | 2.64 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|