C12H13NO2Se — CID 156612535
11b-hydroxy-1,3,4,5-tetrahydro-[1,4]selenazepino[3,4-a]isoindol-7-one (PubChem CID 156612535) has the molecular formula C12H13NO2Se and a molecular weight of 282.20 g/mol. Its IUPAC name is 11b-hydroxy-1,3,4,5-tetrahydro-[1,4]selenazepino[3,4-a]isoindol-7-one.
| Compound Name | 11b-hydroxy-1,3,4,5-tetrahydro-[1,4]selenazepino[3,4-a]isoindol-7-one |
|---|---|
| PubChem CID | 156612535 |
| Molecular Formula | C12H13NO2Se |
| Molecular Weight | 282.20 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | 11b-hydroxy-1,3,4,5-tetrahydro-[1,4]selenazepino[3,4-a]isoindol-7-one |
| SMILES | O=C1c2ccccc2C2(O)C[Se]CCCN12 |
| InChI | InChI=1S/C12H13NO2Se/c14-11-9-4-1-2-5-10(9)12(15)8-16-7-3-6-13(11)12/h1-2,4-5,15H,3,6-8H2 |
| InChIKey | KQRRDAOWFVRCOK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.20 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|