About 2'-(deuteriomethyl)spiro[cyclopropane-1,3'-isoindole]-1'-one
2'-(deuteriomethyl)spiro[cyclopropane-1,3'-isoindole]-1'-one (PubChem CID 175898513) has the molecular formula C11H11NO
and a molecular weight of 174.22 g/mol. Its IUPAC name is 2'-(deuteriomethyl)spiro[cyclopropane-1,3'-isoindole]-1'-one.
Molecular Properties
| Compound Name | 2'-(deuteriomethyl)spiro[cyclopropane-1,3'-isoindole]-1'-one |
| PubChem CID | 175898513 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 2'-(deuteriomethyl)spiro[cyclopropane-1,3'-isoindole]-1'-one |
| SMILES | [2H]CN1C(=O)c2ccccc2C12CC2 |
| InChI | InChI=1S/C11H11NO/c1-12-10(13)8-4-2-3-5-9(8)11(12)6-7-11/h2-5H,6-7H2,1H3/i1D |
| InChIKey | POIRCARAYNXYDY-MICDWDOJSA-N |
| XLogP | 1.76 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2'-(deuteriomethyl)spiro[cyclopropane-1,3'-isoindole]-1'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-(deuteriomethyl)spiro[cyclopropane-1,3'-isoindole]-1'-one?
The IUPAC name of 2'-(deuteriomethyl)spiro[cyclopropane-1,3'-isoindole]-1'-one (CID 175898513) is 2'-(deuteriomethyl)spiro[cyclopropane-1,3'-isoindole]-1'-one.
What is the SMILES notation for 2'-(deuteriomethyl)spiro[cyclopropane-1,3'-isoindole]-1'-one?
The canonical SMILES for 2'-(deuteriomethyl)spiro[cyclopropane-1,3'-isoindole]-1'-one is [2H]CN1C(=O)c2ccccc2C12CC2.
What is the InChIKey of 2'-(deuteriomethyl)spiro[cyclopropane-1,3'-isoindole]-1'-one?
The InChIKey is POIRCARAYNXYDY-MICDWDOJSA-N. The full InChI is InChI=1S/C11H11NO/c1-12-10(13)8-4-2-3-5-9(8)11(12)6-7-11/h2-5H,6-7H2,1H3/i1D.
What are the key properties of 2'-(deuteriomethyl)spiro[cyclopropane-1,3'-isoindole]-1'-one?
2'-(deuteriomethyl)spiro[cyclopropane-1,3'-isoindole]-1'-one has a molecular weight of 174.22 g/mol, XLogP of 1.76, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-(deuteriomethyl)spiro[cyclopropane-1,3'-isoindole]-1'-one is sourced from PubChem (CID 175898513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).