C13H19NO3 — CID 90770318
3,3-bis(hydroxymethyl)-2-methylisoindol-1-one;ethane (PubChem CID 90770318) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 3,3-bis(hydroxymethyl)-2-methylisoindol-1-one;ethane.
| Compound Name | 3,3-bis(hydroxymethyl)-2-methylisoindol-1-one;ethane |
|---|---|
| PubChem CID | 90770318 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 3,3-bis(hydroxymethyl)-2-methylisoindol-1-one;ethane |
| SMILES | CC.CN1C(=O)c2ccccc2C1(CO)CO |
| InChI | InChI=1S/C11H13NO3.C2H6/c1-12-10(15)8-4-2-3-5-9(8)11(12,6-13)7-14;1-2/h2-5,13-14H,6-7H2,1H3;1-2H3 |
| InChIKey | WPMSILRRIHGEQT-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |