C11H11BrO3S — CID 59051960
ethyl 5-bromo-4-oxo-6,7-dihydro-1-benzothiophene-5-carboxylate (PubChem CID 59051960) has the molecular formula C11H11BrO3S and a molecular weight of 303.18 g/mol. Its IUPAC name is ethyl 5-bromo-4-oxo-6,7-dihydro-1-benzothiophene-5-carboxylate.
| Compound Name | ethyl 5-bromo-4-oxo-6,7-dihydro-1-benzothiophene-5-carboxylate |
|---|---|
| PubChem CID | 59051960 |
| Molecular Formula | C11H11BrO3S |
| Molecular Weight | 303.18 g/mol |
| Exact Mass | 301.96 |
| IUPAC Name | ethyl 5-bromo-4-oxo-6,7-dihydro-1-benzothiophene-5-carboxylate |
| SMILES | CCOC(=O)C1(Br)CCc2sccc2C1=O |
| InChI | InChI=1S/C11H11BrO3S/c1-2-15-10(14)11(12)5-3-8-7(9(11)13)4-6-16-8/h4,6H,2-3,5H2,1H3 |
| InChIKey | GLJPAJXIGFRBDG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.18 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|