C20H19NO5 — CID 102391570
methyl (2S)-2-[(1R)-1-(4-methylphenyl)-2-nitroethyl]-3-oxo-1H-indene-2-carboxylate (PubChem CID 102391570) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is methyl (2S)-2-[(1R)-1-(4-methylphenyl)-2-nitroethyl]-3-oxo-1H-indene-2-carboxylate.
| Compound Name | methyl (2S)-2-[(1R)-1-(4-methylphenyl)-2-nitroethyl]-3-oxo-1H-indene-2-carboxylate |
|---|---|
| PubChem CID | 102391570 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | methyl (2S)-2-[(1R)-1-(4-methylphenyl)-2-nitroethyl]-3-oxo-1H-indene-2-carboxylate |
| SMILES | COC(=O)[C@]1([C@H](C[N+](=O)[O-])c2ccc(C)cc2)Cc2ccccc2C1=O |
| InChI | InChI=1S/C20H19NO5/c1-13-7-9-14(10-8-13)17(12-21(24)25)20(19(23)26-2)11-15-5-3-4-6-16(15)18(20)22/h3-10,17H,11-12H2,1-2H3/t17-,20+/m1/s1 |
| InChIKey | OKMLPASAOWOAJW-XLIONFOSSA-N |
| XLogP | 2.95 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|