C21H22NO3- — CID 134962875
methyl (2S)-2-[(1R)-1-cyclopenta-1,3-dien-1-yl-3-oxobutyl]-5-phenyl-3,4-dihydropyrrole-2-carboxylate (PubChem CID 134962875) has the molecular formula C21H22NO3- and a molecular weight of 336.41 g/mol. Its IUPAC name is methyl (2S)-2-[(1R)-1-cyclopenta-1,3-dien-1-yl-3-oxobutyl]-5-phenyl-3,4-dihydropyrrole-2-carboxylate.
| Compound Name | methyl (2S)-2-[(1R)-1-cyclopenta-1,3-dien-1-yl-3-oxobutyl]-5-phenyl-3,4-dihydropyrrole-2-carboxylate |
|---|---|
| PubChem CID | 134962875 |
| Molecular Formula | C21H22NO3- |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | methyl (2S)-2-[(1R)-1-cyclopenta-1,3-dien-1-yl-3-oxobutyl]-5-phenyl-3,4-dihydropyrrole-2-carboxylate |
| SMILES | COC(=O)[C@@]1([C@H](CC(C)=O)c2ccc[cH-]2)CCC(c2ccccc2)=N1 |
| InChI | InChI=1S/C21H22NO3/c1-15(23)14-18(16-8-6-7-9-16)21(20(24)25-2)13-12-19(22-21)17-10-4-3-5-11-17/h3-11,18H,12-14H2,1-2H3/q-1/t18-,21+/m1/s1 |
| InChIKey | RUBSPXWAKBBERP-NQIIRXRSSA-N |
| XLogP | 3.66 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|