C23H26N2O4 — CID 132966135
tert-butyl (2R)-2-[(1R)-2-nitro-1-phenylethyl]-5-phenyl-3,4-dihydropyrrole-2-carboxylate (PubChem CID 132966135) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(1R)-2-nitro-1-phenylethyl]-5-phenyl-3,4-dihydropyrrole-2-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(1R)-2-nitro-1-phenylethyl]-5-phenyl-3,4-dihydropyrrole-2-carboxylate |
|---|---|
| PubChem CID | 132966135 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | tert-butyl (2R)-2-[(1R)-2-nitro-1-phenylethyl]-5-phenyl-3,4-dihydropyrrole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@]1([C@@H](C[N+](=O)[O-])c2ccccc2)CCC(c2ccccc2)=N1 |
| InChI | InChI=1S/C23H26N2O4/c1-22(2,3)29-21(26)23(15-14-20(24-23)18-12-8-5-9-13-18)19(16-25(27)28)17-10-6-4-7-11-17/h4-13,19H,14-16H2,1-3H3/t19-,23+/m0/s1 |
| InChIKey | URCTXIVLTUNNAV-WMZHIEFXSA-N |
| XLogP | 4.41 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|