C21H20BrNO6 — CID 139184449
tert-butyl (1S)-1-[(1R)-1-(4-bromophenyl)-2-nitroethyl]-3-oxo-2-benzofuran-1-carboxylate (PubChem CID 139184449) has the molecular formula C21H20BrNO6 and a molecular weight of 462.30 g/mol. Its IUPAC name is tert-butyl (1S)-1-[(1R)-1-(4-bromophenyl)-2-nitroethyl]-3-oxo-2-benzofuran-1-carboxylate.
| Compound Name | tert-butyl (1S)-1-[(1R)-1-(4-bromophenyl)-2-nitroethyl]-3-oxo-2-benzofuran-1-carboxylate |
|---|---|
| PubChem CID | 139184449 |
| Molecular Formula | C21H20BrNO6 |
| Molecular Weight | 462.30 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | tert-butyl (1S)-1-[(1R)-1-(4-bromophenyl)-2-nitroethyl]-3-oxo-2-benzofuran-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@]1([C@@H](C[N+](=O)[O-])c2ccc(Br)cc2)OC(=O)c2ccccc21 |
| InChI | InChI=1S/C21H20BrNO6/c1-20(2,3)29-19(25)21(16-7-5-4-6-15(16)18(24)28-21)17(12-23(26)27)13-8-10-14(22)11-9-13/h4-11,17H,12H2,1-3H3/t17-,21+/m0/s1 |
| InChIKey | NGGKUWRORKBULZ-LAUBAEHRSA-N |
| XLogP | 4.22 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.30 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|